| Шығарылым |
Бөлім |
Атауы |
Файл |
| Том 61, № 10 (2016) |
Coordination Compounds |
Synthesis and ion-selective properties of 1,2-bis[2-((2-diphenylphosphorylmethyl)phenoxy)ethoxy]cyclohexane (L) and its structural analogs. Crystal structure of L |
|
| Том 61, № 3 (2016) |
Physical Chemistry of Solutions |
Bis(diphenylphosphorylmethyl) ethers of oligo(ethylene glycols) Ph2P(O)CH2O(CH2CH2O)nCH2P(O)Ph2 (n = 1–3): Complexation and extraction of rare-earth elements. Crystal structure of [NdL3(NO3)3(H2O)] |
|
| Том 62, № 4 (2017) |
Coordination Compounds |
Complex-forming and ion-selective properties of bis(2-diphenylphosphorylalkyl)phenyl ethers of ethylene glycols. Crystal structures of cadmium complexes |
|
| Том 63, № 10 (2018) |
Physical Chemistry of Solutions |
Phosphoryl Podands Ph2P(O)CH2O(CH2CH2O)nCH2P(O)Ph2 (Ln, n = 0–5): Complexation and Extraction of Rare Earth Elements. Crystal Structures of [Ln2L03(NO3)6] · xH2O (Ln = Nd, x = 1.99; Ln = Eu, x = 1; Ln = Er, x = 6.5; Ln = Lu, x = 6) and [LnL2(NO3)3(H2O)] (Ln = Nd, Er) |
|
| Том 64, № 2 (2019) |
Coordination Compounds |
1,8-Bis[2-(diphenylphosphoryl)phenoxy-4-phenyldiazenyl)]-3,6-dioxaoctane (L): Synthesis and Complexing and Ion-Selective Properties. Crystal and Molecular Structures of L · 0.25H2O and [LiL]I3 · MePh |
|
| Том 64, № 5 (2019) |
Physical Chemistry of Solutions |
Extraction of Rare Earth Elements in 1,1,7-Trihydrododecafluoroheptanol–Water System with Phosphoryl Podands Derived from Diphosphonic Acids |
|
